C12H17N3O — CID 107269156
2-(4-hydroxypentylamino)-4-methylpyridine-3-carbonitrile (PubChem CID 107269156) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(4-hydroxypentylamino)-4-methylpyridine-3-carbonitrile.
| Compound Name | 2-(4-hydroxypentylamino)-4-methylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 107269156 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-(4-hydroxypentylamino)-4-methylpyridine-3-carbonitrile |
| SMILES | Cc1ccnc(NCCCC(C)O)c1C#N |
| InChI | InChI=1S/C12H17N3O/c1-9-5-7-15-12(11(9)8-13)14-6-3-4-10(2)16/h5,7,10,16H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | LNBXZZXJCNNHLF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|