C10H15BrN2O — CID 106876006
4-[(3-bromo-4-methyl-2-pyridinyl)amino]butan-1-ol (PubChem CID 106876006) has the molecular formula C10H15BrN2O and a molecular weight of 259.15 g/mol. Its IUPAC name is 4-[(3-bromo-4-methyl-2-pyridinyl)amino]butan-1-ol.
| Compound Name | 4-[(3-bromo-4-methyl-2-pyridinyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106876006 |
| Molecular Formula | C10H15BrN2O |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 4-[(3-bromo-4-methyl-2-pyridinyl)amino]butan-1-ol |
| SMILES | Cc1ccnc(NCCCCO)c1Br |
| InChI | InChI=1S/C10H15BrN2O/c1-8-4-6-13-10(9(8)11)12-5-2-3-7-14/h4,6,14H,2-3,5,7H2,1H3,(H,12,13) |
| InChIKey | CWZHABRHEWNVOQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|