C15H24BrN3O — CID 106876136
N-[3-(4-aminocyclohexyl)oxypropyl]-3-bromo-4-methylpyridin-2-amine (PubChem CID 106876136) has the molecular formula C15H24BrN3O and a molecular weight of 342.28 g/mol. Its IUPAC name is N-[3-(4-aminocyclohexyl)oxypropyl]-3-bromo-4-methylpyridin-2-amine.
| Compound Name | N-[3-(4-aminocyclohexyl)oxypropyl]-3-bromo-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106876136 |
| Molecular Formula | C15H24BrN3O |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-[3-(4-aminocyclohexyl)oxypropyl]-3-bromo-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(NCCCOC2CCC(N)CC2)c1Br |
| InChI | InChI=1S/C15H24BrN3O/c1-11-7-9-19-15(14(11)16)18-8-2-10-20-13-5-3-12(17)4-6-13/h7,9,12-13H,2-6,8,10,17H2,1H3,(H,18,19) |
| InChIKey | FUXMAJJTPCIOKK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|