C8H10BrClN2 — CID 106878907
3-bromo-N-(2-chloroethyl)-4-methylpyridin-2-amine (PubChem CID 106878907) has the molecular formula C8H10BrClN2 and a molecular weight of 249.54 g/mol. Its IUPAC name is 3-bromo-N-(2-chloroethyl)-4-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-(2-chloroethyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106878907 |
| Molecular Formula | C8H10BrClN2 |
| Molecular Weight | 249.54 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 3-bromo-N-(2-chloroethyl)-4-methylpyridin-2-amine |
| SMILES | Cc1ccnc(NCCCl)c1Br |
| InChI | InChI=1S/C8H10BrClN2/c1-6-2-4-11-8(7(6)9)12-5-3-10/h2,4H,3,5H2,1H3,(H,11,12) |
| InChIKey | QUVVBNQDBXNVHF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.54 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|