C11H16BrClN2 — CID 106879056
3-bromo-N-(2-chloropentyl)-4-methylpyridin-2-amine (PubChem CID 106879056) has the molecular formula C11H16BrClN2 and a molecular weight of 291.62 g/mol. Its IUPAC name is 3-bromo-N-(2-chloropentyl)-4-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-(2-chloropentyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106879056 |
| Molecular Formula | C11H16BrClN2 |
| Molecular Weight | 291.62 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 3-bromo-N-(2-chloropentyl)-4-methylpyridin-2-amine |
| SMILES | CCCC(Cl)CNc1nccc(C)c1Br |
| InChI | InChI=1S/C11H16BrClN2/c1-3-4-9(13)7-15-11-10(12)8(2)5-6-14-11/h5-6,9H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | GCHRNPJTWXHZMR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|