C12H19BrN2 — CID 106875971
3-bromo-N-(2-ethylbutyl)-4-methylpyridin-2-amine (PubChem CID 106875971) has the molecular formula C12H19BrN2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 3-bromo-N-(2-ethylbutyl)-4-methylpyridin-2-amine.
| Compound Name | 3-bromo-N-(2-ethylbutyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 106875971 |
| Molecular Formula | C12H19BrN2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-bromo-N-(2-ethylbutyl)-4-methylpyridin-2-amine |
| SMILES | CCC(CC)CNc1nccc(C)c1Br |
| InChI | InChI=1S/C12H19BrN2/c1-4-10(5-2)8-15-12-11(13)9(3)6-7-14-12/h6-7,10H,4-5,8H2,1-3H3,(H,14,15) |
| InChIKey | PBAZKEXZVXHXHC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |