C13H19BrN2O2 — CID 106878486
methyl 6-[(3-bromo-4-methyl-2-pyridinyl)amino]hexanoate (PubChem CID 106878486) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is methyl 6-[(3-bromo-4-methyl-2-pyridinyl)amino]hexanoate.
| Compound Name | methyl 6-[(3-bromo-4-methyl-2-pyridinyl)amino]hexanoate |
|---|---|
| PubChem CID | 106878486 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | methyl 6-[(3-bromo-4-methyl-2-pyridinyl)amino]hexanoate |
| SMILES | COC(=O)CCCCCNc1nccc(C)c1Br |
| InChI | InChI=1S/C13H19BrN2O2/c1-10-7-9-16-13(12(10)14)15-8-5-3-4-6-11(17)18-2/h7,9H,3-6,8H2,1-2H3,(H,15,16) |
| InChIKey | WJGOKIYXHDDCCZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|