C16H20N2O2 — CID 62005474
methyl 6-(quinolin-4-ylamino)hexanoate (PubChem CID 62005474) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is methyl 6-(quinolin-4-ylamino)hexanoate.
| Compound Name | methyl 6-(quinolin-4-ylamino)hexanoate |
|---|---|
| PubChem CID | 62005474 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | methyl 6-(quinolin-4-ylamino)hexanoate |
| SMILES | COC(=O)CCCCCNc1ccnc2ccccc12 |
| InChI | InChI=1S/C16H20N2O2/c1-20-16(19)9-3-2-6-11-17-15-10-12-18-14-8-5-4-7-13(14)15/h4-5,7-8,10,12H,2-3,6,9,11H2,1H3,(H,17,18) |
| InChIKey | VZYHZHBCBZWFJB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|