C29H51N3O2 — CID 118576144
6-butoxyhexan-1-amine;N-(6-butoxyhexyl)quinolin-4-amine (PubChem CID 118576144) has the molecular formula C29H51N3O2 and a molecular weight of 473.75 g/mol. Its IUPAC name is 6-butoxyhexan-1-amine;N-(6-butoxyhexyl)quinolin-4-amine.
| Compound Name | 6-butoxyhexan-1-amine;N-(6-butoxyhexyl)quinolin-4-amine |
|---|---|
| PubChem CID | 118576144 |
| Molecular Formula | C29H51N3O2 |
| Molecular Weight | 473.75 g/mol |
| Exact Mass | 473.40 |
| IUPAC Name | 6-butoxyhexan-1-amine;N-(6-butoxyhexyl)quinolin-4-amine |
| SMILES | CCCCOCCCCCCN.CCCCOCCCCCCNc1ccnc2ccccc12 |
| InChI | InChI=1S/C19H28N2O.C10H23NO/c1-2-3-15-22-16-9-5-4-8-13-20-19-12-14-21-18-11-7-6-10-17(18)19;1-2-3-9-12-10-7-5-4-6-8-11/h6-7,10-12,14H,2-5,8-9,13,15-16H2,1H3,(H,20,21);2-11H2,1H3 |
| InChIKey | ARADSIVELGZUSZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.75 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|