About N-ethylquinolin-4-amine
N-ethylquinolin-4-amine (PubChem CID 15306588) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is N-ethylquinolin-4-amine.
Molecular Properties
| Compound Name | N-ethylquinolin-4-amine |
| PubChem CID | 15306588 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N-ethylquinolin-4-amine |
| SMILES | CCNc1ccnc2ccccc12 |
| InChI | InChI=1S/C11H12N2/c1-2-12-11-7-8-13-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3,(H,12,13) |
| InChIKey | TTXHGYGDDOYSDB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylquinolin-4-amine?
The IUPAC name of N-ethylquinolin-4-amine (CID 15306588) is N-ethylquinolin-4-amine.
What is the SMILES notation for N-ethylquinolin-4-amine?
The canonical SMILES for N-ethylquinolin-4-amine is CCNc1ccnc2ccccc12.
What is the InChIKey of N-ethylquinolin-4-amine?
The InChIKey is TTXHGYGDDOYSDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-2-12-11-7-8-13-10-6-4-3-5-9(10)11/h3-8H,2H2,1H3,(H,12,13).
What are the key properties of N-ethylquinolin-4-amine?
N-ethylquinolin-4-amine has a molecular weight of 172.23 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylquinolin-4-amine is sourced from PubChem (CID 15306588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).