C11H10F2N2 — CID 79099279
N-(2,2-difluoroethyl)quinolin-4-amine (PubChem CID 79099279) has the molecular formula C11H10F2N2 and a molecular weight of 208.21 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)quinolin-4-amine.
| Compound Name | N-(2,2-difluoroethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 79099279 |
| Molecular Formula | C11H10F2N2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-(2,2-difluoroethyl)quinolin-4-amine |
| SMILES | FC(F)CNc1ccnc2ccccc12 |
| InChI | InChI=1S/C11H10F2N2/c12-11(13)7-15-10-5-6-14-9-4-2-1-3-8(9)10/h1-6,11H,7H2,(H,14,15) |
| InChIKey | YGQJMHITULEBDG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |