C12H15N3 — CID 62658935
N-methyl-N'-quinolin-4-ylethane-1,2-diamine (PubChem CID 62658935) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-methyl-N'-quinolin-4-ylethane-1,2-diamine.
| Compound Name | N-methyl-N'-quinolin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62658935 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-methyl-N'-quinolin-4-ylethane-1,2-diamine |
| SMILES | CNCCNc1ccnc2ccccc12 |
| InChI | InChI=1S/C12H15N3/c1-13-8-9-15-12-6-7-14-11-5-3-2-4-10(11)12/h2-7,13H,8-9H2,1H3,(H,14,15) |
| InChIKey | ZPELGCKCYASDGP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|