C15H19N3 — CID 62979742
N'-cyclopropyl-N'-methyl-N-quinolin-4-ylethane-1,2-diamine (PubChem CID 62979742) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N'-cyclopropyl-N'-methyl-N-quinolin-4-ylethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N'-methyl-N-quinolin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62979742 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N'-cyclopropyl-N'-methyl-N-quinolin-4-ylethane-1,2-diamine |
| SMILES | CN(CCNc1ccnc2ccccc12)C1CC1 |
| InChI | InChI=1S/C15H19N3/c1-18(12-6-7-12)11-10-17-15-8-9-16-14-5-3-2-4-13(14)15/h2-5,8-9,12H,6-7,10-11H2,1H3,(H,16,17) |
| InChIKey | NBEMIRXHEONZHY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |