C12H17ClN4O8 — CID 160597532
bis(nitric acid);3-(quinolin-4-ylamino)propane-1,2-diol;hydrochloride (PubChem CID 160597532) has the molecular formula C12H17ClN4O8 and a molecular weight of 380.74 g/mol. Its IUPAC name is bis(nitric acid);3-(quinolin-4-ylamino)propane-1,2-diol;hydrochloride.
| Compound Name | bis(nitric acid);3-(quinolin-4-ylamino)propane-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 160597532 |
| Molecular Formula | C12H17ClN4O8 |
| Molecular Weight | 380.74 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | bis(nitric acid);3-(quinolin-4-ylamino)propane-1,2-diol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])O.O=[N+]([O-])O.OCC(O)CNc1ccnc2ccccc12 |
| InChI | InChI=1S/C12H14N2O2.ClH.2HNO3/c15-8-9(16)7-14-12-5-6-13-11-4-2-1-3-10(11)12;;2*2-1(3)4/h1-6,9,15-16H,7-8H2,(H,13,14);1H;2*(H,2,3,4) |
| InChIKey | RDVIZRKYYAOGFN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 192.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.74 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|