C13H15NO2 — CID 3017963
3-(naphthalen-1-ylamino)propane-1,2-diol (PubChem CID 3017963) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(naphthalen-1-ylamino)propane-1,2-diol.
| Compound Name | 3-(naphthalen-1-ylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 3017963 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-(naphthalen-1-ylamino)propane-1,2-diol |
| SMILES | OCC(O)CNc1cccc2ccccc12 |
| InChI | InChI=1S/C13H15NO2/c15-9-11(16)8-14-13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11,14-16H,8-9H2 |
| InChIKey | FFDICKQFLGMKFP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |