C13H15NO3 — CID 168593345
3-[(6-hydroxynaphthalen-1-yl)amino]propane-1,2-diol (PubChem CID 168593345) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-[(6-hydroxynaphthalen-1-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(6-hydroxynaphthalen-1-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 168593345 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-[(6-hydroxynaphthalen-1-yl)amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cccc2cc(O)ccc12 |
| InChI | InChI=1S/C13H15NO3/c15-8-11(17)7-14-13-3-1-2-9-6-10(16)4-5-12(9)13/h1-6,11,14-17H,7-8H2 |
| InChIKey | VVHBYIUAJNPVTM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |