C12H13ClN2O2 — CID 168596797
3-[(2-chloroquinolin-8-yl)amino]propane-1,2-diol (PubChem CID 168596797) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is 3-[(2-chloroquinolin-8-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(2-chloroquinolin-8-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 168596797 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-[(2-chloroquinolin-8-yl)amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cccc2ccc(Cl)nc12 |
| InChI | InChI=1S/C12H13ClN2O2/c13-11-5-4-8-2-1-3-10(12(8)15-11)14-6-9(17)7-16/h1-5,9,14,16-17H,6-7H2 |
| InChIKey | AOKVWJITRAWFAN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|