C13H16N2O2 — CID 168596036
3-[(7-methylquinolin-8-yl)amino]propane-1,2-diol (PubChem CID 168596036) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-[(7-methylquinolin-8-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(7-methylquinolin-8-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 168596036 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-[(7-methylquinolin-8-yl)amino]propane-1,2-diol |
| SMILES | Cc1ccc2cccnc2c1NCC(O)CO |
| InChI | InChI=1S/C13H16N2O2/c1-9-4-5-10-3-2-6-14-13(10)12(9)15-7-11(17)8-16/h2-6,11,15-17H,7-8H2,1H3 |
| InChIKey | APCYOROLSHWOMI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |