About 8-N-hexylquinoline-7,8-diamine;dihydrochloride
8-N-hexylquinoline-7,8-diamine;dihydrochloride (PubChem CID 12887821) has the molecular formula C15H23Cl2N3
and a molecular weight of 316.28 g/mol. Its IUPAC name is 8-N-hexylquinoline-7,8-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 8-N-hexylquinoline-7,8-diamine;dihydrochloride |
| PubChem CID | 12887821 |
| Molecular Formula | C15H23Cl2N3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 8-N-hexylquinoline-7,8-diamine;dihydrochloride |
| SMILES | CCCCCCNc1c(N)ccc2cccnc12.Cl.Cl |
| InChI | InChI=1S/C15H21N3.2ClH/c1-2-3-4-5-10-18-15-13(16)9-8-12-7-6-11-17-14(12)15;;/h6-9,11,18H,2-5,10,16H2,1H3;2*1H |
| InChIKey | VOCPAOGLQCFLCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-N-hexylquinoline-7,8-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N-hexylquinoline-7,8-diamine;dihydrochloride?
The IUPAC name of 8-N-hexylquinoline-7,8-diamine;dihydrochloride (CID 12887821) is 8-N-hexylquinoline-7,8-diamine;dihydrochloride.
What is the SMILES notation for 8-N-hexylquinoline-7,8-diamine;dihydrochloride?
The canonical SMILES for 8-N-hexylquinoline-7,8-diamine;dihydrochloride is CCCCCCNc1c(N)ccc2cccnc12.Cl.Cl.
What is the InChIKey of 8-N-hexylquinoline-7,8-diamine;dihydrochloride?
The InChIKey is VOCPAOGLQCFLCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3.2ClH/c1-2-3-4-5-10-18-15-13(16)9-8-12-7-6-11-17-14(12)15;;/h6-9,11,18H,2-5,10,16H2,1H3;2*1H.
What are the key properties of 8-N-hexylquinoline-7,8-diamine;dihydrochloride?
8-N-hexylquinoline-7,8-diamine;dihydrochloride has a molecular weight of 316.28 g/mol, XLogP of 4.65, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N-hexylquinoline-7,8-diamine;dihydrochloride is sourced from PubChem (CID 12887821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).