About N-heptylquinolin-8-amine
N-heptylquinolin-8-amine (PubChem CID 43130175) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is N-heptylquinolin-8-amine.
Molecular Properties
| Compound Name | N-heptylquinolin-8-amine |
| PubChem CID | 43130175 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-heptylquinolin-8-amine |
| SMILES | CCCCCCCNc1cccc2cccnc12 |
| InChI | InChI=1S/C16H22N2/c1-2-3-4-5-6-12-17-15-11-7-9-14-10-8-13-18-16(14)15/h7-11,13,17H,2-6,12H2,1H3 |
| InChIKey | RWNXUGRMQRIWQN-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-heptylquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptylquinolin-8-amine?
The IUPAC name of N-heptylquinolin-8-amine (CID 43130175) is N-heptylquinolin-8-amine.
What is the SMILES notation for N-heptylquinolin-8-amine?
The canonical SMILES for N-heptylquinolin-8-amine is CCCCCCCNc1cccc2cccnc12.
What is the InChIKey of N-heptylquinolin-8-amine?
The InChIKey is RWNXUGRMQRIWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2/c1-2-3-4-5-6-12-17-15-11-7-9-14-10-8-13-18-16(14)15/h7-11,13,17H,2-6,12H2,1H3.
What are the key properties of N-heptylquinolin-8-amine?
N-heptylquinolin-8-amine has a molecular weight of 242.37 g/mol, XLogP of 4.62, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptylquinolin-8-amine is sourced from PubChem (CID 43130175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).