About pentylhydrazine;quinoline
pentylhydrazine;quinoline (PubChem CID 175186682) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is pentylhydrazine;quinoline.
Molecular Properties
| Compound Name | pentylhydrazine;quinoline |
| PubChem CID | 175186682 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | pentylhydrazine;quinoline |
| SMILES | CCCCCNN.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C5H14N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-4-5-7-6/h1-7H;7H,2-6H2,1H3 |
| InChIKey | PDJVIIBVKYEPEB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pentylhydrazine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentylhydrazine;quinoline?
The IUPAC name of pentylhydrazine;quinoline (CID 175186682) is pentylhydrazine;quinoline.
What is the SMILES notation for pentylhydrazine;quinoline?
The canonical SMILES for pentylhydrazine;quinoline is CCCCCNN.c1ccc2ncccc2c1.
What is the InChIKey of pentylhydrazine;quinoline?
The InChIKey is PDJVIIBVKYEPEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C5H14N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-4-5-7-6/h1-7H;7H,2-6H2,1H3.
What are the key properties of pentylhydrazine;quinoline?
pentylhydrazine;quinoline has a molecular weight of 231.34 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentylhydrazine;quinoline is sourced from PubChem (CID 175186682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).