About propan-1-ol;quinoline
propan-1-ol;quinoline (PubChem CID 160910097) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is propan-1-ol;quinoline.
Molecular Properties
| Compound Name | propan-1-ol;quinoline |
| PubChem CID | 160910097 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | propan-1-ol;quinoline |
| SMILES | CCCO.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C3H8O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-4/h1-7H;4H,2-3H2,1H3 |
| InChIKey | SQQWSQHTQUXHLH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-1-ol;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-1-ol;quinoline?
The IUPAC name of propan-1-ol;quinoline (CID 160910097) is propan-1-ol;quinoline.
What is the SMILES notation for propan-1-ol;quinoline?
The canonical SMILES for propan-1-ol;quinoline is CCCO.c1ccc2ncccc2c1.
What is the InChIKey of propan-1-ol;quinoline?
The InChIKey is SQQWSQHTQUXHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C3H8O/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-3-4/h1-7H;4H,2-3H2,1H3.
What are the key properties of propan-1-ol;quinoline?
propan-1-ol;quinoline has a molecular weight of 189.26 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-1-ol;quinoline is sourced from PubChem (CID 160910097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).