C14H26N4 — CID 56985914
4-N-decylpyrimidine-2,4-diamine (PubChem CID 56985914) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 4-N-decylpyrimidine-2,4-diamine.
| Compound Name | 4-N-decylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 56985914 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 4-N-decylpyrimidine-2,4-diamine |
| SMILES | CCCCCCCCCCNc1ccnc(N)n1 |
| InChI | InChI=1S/C14H26N4/c1-2-3-4-5-6-7-8-9-11-16-13-10-12-17-14(15)18-13/h10,12H,2-9,11H2,1H3,(H3,15,16,17,18) |
| InChIKey | OPAGHZPGFCVBRJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|