C11H19N3 — CID 21487111
2-N-hexylpyridine-2,5-diamine (PubChem CID 21487111) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-N-hexylpyridine-2,5-diamine.
| Compound Name | 2-N-hexylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 21487111 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-N-hexylpyridine-2,5-diamine |
| SMILES | CCCCCCNc1ccc(N)cn1 |
| InChI | InChI=1S/C11H19N3/c1-2-3-4-5-8-13-11-7-6-10(12)9-14-11/h6-7,9H,2-5,8,12H2,1H3,(H,13,14) |
| InChIKey | GPYAJKDNPJPPTD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|