About 2-N-ethylpyridine-2,5-diamine;hydrochloride
2-N-ethylpyridine-2,5-diamine;hydrochloride (PubChem CID 134080457) has the molecular formula C7H12ClN3
and a molecular weight of 173.65 g/mol. Its IUPAC name is 2-N-ethylpyridine-2,5-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-ethylpyridine-2,5-diamine;hydrochloride |
| PubChem CID | 134080457 |
| Molecular Formula | C7H12ClN3 |
| Molecular Weight | 173.65 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-N-ethylpyridine-2,5-diamine;hydrochloride |
| SMILES | CCNc1ccc(N)cn1.Cl |
| InChI | InChI=1S/C7H11N3.ClH/c1-2-9-7-4-3-6(8)5-10-7;/h3-5H,2,8H2,1H3,(H,9,10);1H |
| InChIKey | AINRLROBMWFPDO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.65 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-ethylpyridine-2,5-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethylpyridine-2,5-diamine;hydrochloride?
The IUPAC name of 2-N-ethylpyridine-2,5-diamine;hydrochloride (CID 134080457) is 2-N-ethylpyridine-2,5-diamine;hydrochloride.
What is the SMILES notation for 2-N-ethylpyridine-2,5-diamine;hydrochloride?
The canonical SMILES for 2-N-ethylpyridine-2,5-diamine;hydrochloride is CCNc1ccc(N)cn1.Cl.
What is the InChIKey of 2-N-ethylpyridine-2,5-diamine;hydrochloride?
The InChIKey is AINRLROBMWFPDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3.ClH/c1-2-9-7-4-3-6(8)5-10-7;/h3-5H,2,8H2,1H3,(H,9,10);1H.
What are the key properties of 2-N-ethylpyridine-2,5-diamine;hydrochloride?
2-N-ethylpyridine-2,5-diamine;hydrochloride has a molecular weight of 173.65 g/mol, XLogP of 1.52, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethylpyridine-2,5-diamine;hydrochloride is sourced from PubChem (CID 134080457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).