C7H12ClN3 — CID 134080457
2-N-ethylpyridine-2,5-diamine;hydrochloride (PubChem CID 134080457) has the molecular formula C7H12ClN3 and a molecular weight of 173.65 g/mol. Its IUPAC name is 2-N-ethylpyridine-2,5-diamine;hydrochloride.
| Compound Name | 2-N-ethylpyridine-2,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 134080457 |
| Molecular Formula | C7H12ClN3 |
| Molecular Weight | 173.65 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-N-ethylpyridine-2,5-diamine;hydrochloride |
| SMILES | CCNc1ccc(N)cn1.Cl |
| InChI | InChI=1S/C7H11N3.ClH/c1-2-9-7-4-3-6(8)5-10-7;/h3-5H,2,8H2,1H3,(H,9,10);1H |
| InChIKey | AINRLROBMWFPDO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.65 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |