C10H17N3 — CID 16775519
2-N-pentan-3-ylpyridine-2,5-diamine (PubChem CID 16775519) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-N-pentan-3-ylpyridine-2,5-diamine.
| Compound Name | 2-N-pentan-3-ylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 16775519 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-N-pentan-3-ylpyridine-2,5-diamine |
| SMILES | CCC(CC)Nc1ccc(N)cn1 |
| InChI | InChI=1S/C10H17N3/c1-3-9(4-2)13-10-6-5-8(11)7-12-10/h5-7,9H,3-4,11H2,1-2H3,(H,12,13) |
| InChIKey | JWWNXXXOZYFQRK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |