C13H21N3O — CID 78956363
N,N-dimethyl-6-(pentan-3-ylamino)pyridine-3-carboxamide (PubChem CID 78956363) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is N,N-dimethyl-6-(pentan-3-ylamino)pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-6-(pentan-3-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78956363 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N,N-dimethyl-6-(pentan-3-ylamino)pyridine-3-carboxamide |
| SMILES | CCC(CC)Nc1ccc(C(=O)N(C)C)cn1 |
| InChI | InChI=1S/C13H21N3O/c1-5-11(6-2)15-12-8-7-10(9-14-12)13(17)16(3)4/h7-9,11H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | RHVWADUCBVOJHF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |