C10H16N4O — CID 83025620
6-(2,2-dimethylhydrazinyl)-N,N-dimethylpyridine-3-carboxamide (PubChem CID 83025620) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 6-(2,2-dimethylhydrazinyl)-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 6-(2,2-dimethylhydrazinyl)-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 83025620 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 6-(2,2-dimethylhydrazinyl)-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)Nc1ccc(C(=O)N(C)C)cn1 |
| InChI | InChI=1S/C10H16N4O/c1-13(2)10(15)8-5-6-9(11-7-8)12-14(3)4/h5-7H,1-4H3,(H,11,12) |
| InChIKey | OPRQQXLSJKHXKH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|