C14H23N3O2 — CID 103918113
6-(6-hydroxyhexylamino)-N,N-dimethylpyridine-3-carboxamide (PubChem CID 103918113) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 6-(6-hydroxyhexylamino)-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 6-(6-hydroxyhexylamino)-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 103918113 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 6-(6-hydroxyhexylamino)-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NCCCCCCO)nc1 |
| InChI | InChI=1S/C14H23N3O2/c1-17(2)14(19)12-7-8-13(16-11-12)15-9-5-3-4-6-10-18/h7-8,11,18H,3-6,9-10H2,1-2H3,(H,15,16) |
| InChIKey | QCIZVTCDAPZFJM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|