C12H18N4O3 — CID 106239261
6-[2-(2-amino-2-oxoethoxy)ethylamino]-N,N-dimethylpyridine-3-carboxamide (PubChem CID 106239261) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-[2-(2-amino-2-oxoethoxy)ethylamino]-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 6-[2-(2-amino-2-oxoethoxy)ethylamino]-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 106239261 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 6-[2-(2-amino-2-oxoethoxy)ethylamino]-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NCCOCC(N)=O)nc1 |
| InChI | InChI=1S/C12H18N4O3/c1-16(2)12(18)9-3-4-11(15-7-9)14-5-6-19-8-10(13)17/h3-4,7H,5-6,8H2,1-2H3,(H2,13,17)(H,14,15) |
| InChIKey | HTPRDAUGQMMJBP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|