C12H16F3N3O2 — CID 78956359
N,N-dimethyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carboxamide (PubChem CID 78956359) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is N,N-dimethyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carboxamide.
| Compound Name | N,N-dimethyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 78956359 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N,N-dimethyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(NCCOCC(F)(F)F)nc1 |
| InChI | InChI=1S/C12H16F3N3O2/c1-18(2)11(19)9-3-4-10(17-7-9)16-5-6-20-8-12(13,14)15/h3-4,7H,5-6,8H2,1-2H3,(H,16,17) |
| InChIKey | YQWDSSOQJNQDFA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|