C11H11F3N2O4 — CID 61317563
6-[3-(2,2,2-trifluoroethoxy)propanoylamino]pyridine-3-carboxylic acid (PubChem CID 61317563) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]pyridine-3-carboxylic acid.
| Compound Name | 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 61317563 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 6-[3-(2,2,2-trifluoroethoxy)propanoylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(CCOCC(F)(F)F)Nc1ccc(C(=O)O)cn1 |
| InChI | InChI=1S/C11H11F3N2O4/c12-11(13,14)6-20-4-3-9(17)16-8-2-1-7(5-15-8)10(18)19/h1-2,5H,3-4,6H2,(H,18,19)(H,15,16,17) |
| InChIKey | RMKSJDNKKKBQIB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|