C11H11F3N2O4 — CID 63650013
4-[3-(2,2,2-trifluoroethoxy)propanoylamino]pyridine-2-carboxylic acid (PubChem CID 63650013) has the molecular formula C11H11F3N2O4 and a molecular weight of 292.21 g/mol. Its IUPAC name is 4-[3-(2,2,2-trifluoroethoxy)propanoylamino]pyridine-2-carboxylic acid.
| Compound Name | 4-[3-(2,2,2-trifluoroethoxy)propanoylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63650013 |
| Molecular Formula | C11H11F3N2O4 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[3-(2,2,2-trifluoroethoxy)propanoylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(CCOCC(F)(F)F)Nc1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C11H11F3N2O4/c12-11(13,14)6-20-4-2-9(17)16-7-1-3-15-8(5-7)10(18)19/h1,3,5H,2,4,6H2,(H,18,19)(H,15,16,17) |
| InChIKey | CCYFGBLEWDAPAC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|