C9H8ClF3N2O2 — CID 86997957
N-(5-chloro-2-pyridinyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 86997957) has the molecular formula C9H8ClF3N2O2 and a molecular weight of 268.62 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 86997957 |
| Molecular Formula | C9H8ClF3N2O2 |
| Molecular Weight | 268.62 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C9H8ClF3N2O2/c10-6-1-2-7(14-3-6)15-8(16)4-17-5-9(11,12)13/h1-3H,4-5H2,(H,14,15,16) |
| InChIKey | HDSBMHCUFZGWGG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |