C13H17F3N4O2 — CID 119494193
N-(5-piperazin-1-yl-2-pyridinyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 119494193) has the molecular formula C13H17F3N4O2 and a molecular weight of 318.30 g/mol. Its IUPAC name is N-(5-piperazin-1-yl-2-pyridinyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(5-piperazin-1-yl-2-pyridinyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 119494193 |
| Molecular Formula | C13H17F3N4O2 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-(5-piperazin-1-yl-2-pyridinyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | O=C(COCC(F)(F)F)Nc1ccc(N2CCNCC2)cn1 |
| InChI | InChI=1S/C13H17F3N4O2/c14-13(15,16)9-22-8-12(21)19-11-2-1-10(7-18-11)20-5-3-17-4-6-20/h1-2,7,17H,3-6,8-9H2,(H,18,19,21) |
| InChIKey | LZOBVVHFKDMOAX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |