C19H15ClN2O3 — CID 2079261
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-naphthalen-1-ylacetate (PubChem CID 2079261) has the molecular formula C19H15ClN2O3 and a molecular weight of 354.79 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 2079261 |
| Molecular Formula | C19H15ClN2O3 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 2-naphthalen-1-ylacetate |
| SMILES | O=C(COC(=O)Cc1cccc2ccccc12)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C19H15ClN2O3/c20-15-8-9-17(21-11-15)22-18(23)12-25-19(24)10-14-6-3-5-13-4-1-2-7-16(13)14/h1-9,11H,10,12H2,(H,21,22,23) |
| InChIKey | AAZSMYDULMBXOB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |