C20H12F5NO3 — CID 3399745
[2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-naphthalen-1-ylacetate (PubChem CID 3399745) has the molecular formula C20H12F5NO3 and a molecular weight of 409.31 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 3399745 |
| Molecular Formula | C20H12F5NO3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [2-oxo-2-(2,3,4,5,6-pentafluoroanilino)ethyl] 2-naphthalen-1-ylacetate |
| SMILES | O=C(COC(=O)Cc1cccc2ccccc12)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H12F5NO3/c21-15-16(22)18(24)20(19(25)17(15)23)26-13(27)9-29-14(28)8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2,(H,26,27) |
| InChIKey | BWYLKWPPYPLNKG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|