C20H15F2NO3 — CID 2625283
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate (PubChem CID 2625283) has the molecular formula C20H15F2NO3 and a molecular weight of 355.34 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 2625283 |
| Molecular Formula | C20H15F2NO3 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-naphthalen-1-ylacetate |
| SMILES | O=C(COC(=O)Cc1cccc2ccccc12)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H15F2NO3/c21-15-8-9-18(17(22)11-15)23-19(24)12-26-20(25)10-14-6-3-5-13-4-1-2-7-16(13)14/h1-9,11H,10,12H2,(H,23,24) |
| InChIKey | QTARRHMEFUKXBL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |