C17H11F2NO4 — CID 7193994
[2-(2,4-difluoroanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate (PubChem CID 7193994) has the molecular formula C17H11F2NO4 and a molecular weight of 331.27 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7193994 |
| Molecular Formula | C17H11F2NO4 |
| Molecular Weight | 331.27 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 1-benzofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2o1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C17H11F2NO4/c18-11-5-6-13(12(19)8-11)20-16(21)9-23-17(22)15-7-10-3-1-2-4-14(10)24-15/h1-8H,9H2,(H,20,21) |
| InChIKey | VUJLDWXPDCHERD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |