C19H13F3N2O5 — CID 7194079
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 1-benzofuran-2-carboxylate (PubChem CID 7194079) has the molecular formula C19H13F3N2O5 and a molecular weight of 406.32 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 1-benzofuran-2-carboxylate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7194079 |
| Molecular Formula | C19H13F3N2O5 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 1-benzofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2ccccc2o1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H13F3N2O5/c20-11-5-6-12(18(22)17(11)21)24-15(25)8-23-16(26)9-28-19(27)14-7-10-3-1-2-4-13(10)29-14/h1-7H,8-9H2,(H,23,26)(H,24,25) |
| InChIKey | TWFRHPYADHGGJY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|