C19H16F3N3O3 — CID 86916154
2-[1-(1-benzofuran-2-yl)ethylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 86916154) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is 2-[1-(1-benzofuran-2-yl)ethylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[1-(1-benzofuran-2-yl)ethylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 86916154 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[1-(1-benzofuran-2-yl)ethylcarbamoylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CC(NC(=O)NCC(=O)Nc1ccc(F)c(F)c1F)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H16F3N3O3/c1-10(15-8-11-4-2-3-5-14(11)28-15)24-19(27)23-9-16(26)25-13-7-6-12(20)17(21)18(13)22/h2-8,10H,9H2,1H3,(H,25,26)(H2,23,24,27) |
| InChIKey | CUQZWGZTIKJMLW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|