C14H16N4O4 — CID 94056544
2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]carbamoylamino]propanediamide (PubChem CID 94056544) has the molecular formula C14H16N4O4 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]carbamoylamino]propanediamide.
| Compound Name | 2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]carbamoylamino]propanediamide |
|---|---|
| PubChem CID | 94056544 |
| Molecular Formula | C14H16N4O4 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 2-[[(1S)-1-(1-benzofuran-2-yl)ethyl]carbamoylamino]propanediamide |
| SMILES | C[C@H](NC(=O)NC(C(N)=O)C(N)=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C14H16N4O4/c1-7(10-6-8-4-2-3-5-9(8)22-10)17-14(21)18-11(12(15)19)13(16)20/h2-7,11H,1H3,(H2,15,19)(H2,16,20)(H2,17,18,21)/t7-/m0/s1 |
| InChIKey | SBHNELGIWRRBOL-ZETCQYMHSA-N |
| XLogP | 0.13 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|