C17H22N2O3 — CID 111103936
1-[1-(1-benzofuran-2-yl)ethyl]-3-[(1-hydroxycyclopentyl)methyl]urea (PubChem CID 111103936) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-[(1-hydroxycyclopentyl)methyl]urea.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-[(1-hydroxycyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 111103936 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-[(1-hydroxycyclopentyl)methyl]urea |
| SMILES | CC(NC(=O)NCC1(O)CCCC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H22N2O3/c1-12(15-10-13-6-2-3-7-14(13)22-15)19-16(20)18-11-17(21)8-4-5-9-17/h2-3,6-7,10,12,21H,4-5,8-9,11H2,1H3,(H2,18,19,20) |
| InChIKey | VGRRWCWCXDFKNJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |