C19H17F3N2O2 — CID 41182500
1-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 41182500) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 1-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 41182500 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[(1R)-1-(1-benzofuran-2-yl)ethyl]-3-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | C[C@@H](NC(=O)NCc1cccc(C(F)(F)F)c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H17F3N2O2/c1-12(17-10-14-6-2-3-8-16(14)26-17)24-18(25)23-11-13-5-4-7-15(9-13)19(20,21)22/h2-10,12H,11H2,1H3,(H2,23,24,25)/t12-/m1/s1 |
| InChIKey | IQFVXQYCQBTRNE-GFCCVEGCSA-N |
| XLogP | 5.01 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |