C17H17F3N2O — CID 27533694
1-benzyl-3-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 27533694) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is 1-benzyl-3-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-benzyl-3-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 27533694 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-benzyl-3-[(1S)-1-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | C[C@H](NC(=O)NCc1ccccc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O/c1-12(14-8-5-9-15(10-14)17(18,19)20)22-16(23)21-11-13-6-3-2-4-7-13/h2-10,12H,11H2,1H3,(H2,21,22,23)/t12-/m0/s1 |
| InChIKey | QKXHKODJUGBYBO-LBPRGKRZSA-N |
| XLogP | 4.27 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |