C15H19ClF3N3O2 — CID 95150741
(2R)-2-chloro-N-[2-[[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]carbamoylamino]ethyl]propanamide (PubChem CID 95150741) has the molecular formula C15H19ClF3N3O2 and a molecular weight of 365.78 g/mol. Its IUPAC name is (2R)-2-chloro-N-[2-[[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]carbamoylamino]ethyl]propanamide.
| Compound Name | (2R)-2-chloro-N-[2-[[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]carbamoylamino]ethyl]propanamide |
|---|---|
| PubChem CID | 95150741 |
| Molecular Formula | C15H19ClF3N3O2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (2R)-2-chloro-N-[2-[[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]carbamoylamino]ethyl]propanamide |
| SMILES | C[C@@H](Cl)C(=O)NCCNC(=O)N[C@H](C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19ClF3N3O2/c1-9(16)13(23)20-6-7-21-14(24)22-10(2)11-4-3-5-12(8-11)15(17,18)19/h3-5,8-10H,6-7H2,1-2H3,(H,20,23)(H2,21,22,24)/t9-,10-/m1/s1 |
| InChIKey | SOVWOOFLXAHZIV-NXEZZACHSA-N |
| XLogP | 2.81 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|