C12H12F3NO — CID 43699818
N-[1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide (PubChem CID 43699818) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide.
| Compound Name | N-[1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 43699818 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[1-[3-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3NO/c1-3-11(17)16-8(2)9-5-4-6-10(7-9)12(13,14)15/h3-8H,1H2,2H3,(H,16,17) |
| InChIKey | FSIZXDYPGRUZAF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|