C17H13F4NO — CID 154867848
N-[(4-fluorophenyl)-[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 154867848) has the molecular formula C17H13F4NO and a molecular weight of 323.29 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | N-[(4-fluorophenyl)-[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 154867848 |
| Molecular Formula | C17H13F4NO |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[(4-fluorophenyl)-[3-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(c1ccc(F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F4NO/c1-2-15(23)22-16(11-6-8-14(18)9-7-11)12-4-3-5-13(10-12)17(19,20)21/h2-10,16H,1H2,(H,22,23) |
| InChIKey | HTFPMLKLVITLBO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|