C27H23F3N2O2 — CID 135302446
(E)-3-[3-[phenyl-(prop-2-enoylamino)methyl]phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide (PubChem CID 135302446) has the molecular formula C27H23F3N2O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is (E)-3-[3-[phenyl-(prop-2-enoylamino)methyl]phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[3-[phenyl-(prop-2-enoylamino)methyl]phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 135302446 |
| Molecular Formula | C27H23F3N2O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (E)-3-[3-[phenyl-(prop-2-enoylamino)methyl]phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(c1ccccc1)c1cccc(/C=C/C(=O)NCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H23F3N2O2/c1-2-24(33)32-26(21-8-4-3-5-9-21)22-10-6-7-19(17-22)13-16-25(34)31-18-20-11-14-23(15-12-20)27(28,29)30/h2-17,26H,1,18H2,(H,31,34)(H,32,33)/b16-13+ |
| InChIKey | DMKUMGPQNYSTIL-DTQAZKPQSA-N |
| XLogP | 5.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|