C25H30F3N2O2+ — CID 25269512
dimethyl-(oxan-4-yl)-[[4-[[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]methyl]azanium (PubChem CID 25269512) has the molecular formula C25H30F3N2O2+ and a molecular weight of 447.52 g/mol. Its IUPAC name is dimethyl-(oxan-4-yl)-[[4-[[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]methyl]azanium.
| Compound Name | dimethyl-(oxan-4-yl)-[[4-[[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 25269512 |
| Molecular Formula | C25H30F3N2O2+ |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | dimethyl-(oxan-4-yl)-[[4-[[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]methyl]phenyl]methyl]azanium |
| SMILES | C[N+](C)(Cc1ccc(CNC(=O)/C=C/c2cccc(C(F)(F)F)c2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C25H29F3N2O2/c1-30(2,23-12-14-32-15-13-23)18-21-8-6-20(7-9-21)17-29-24(31)11-10-19-4-3-5-22(16-19)25(26,27)28/h3-11,16,23H,12-15,17-18H2,1-2H3/p+1/b11-10+ |
| InChIKey | ZZKSQJQVYMFUIT-ZHACJKMWSA-O |
| XLogP | 4.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|